About spiro[2.5]octan-8-amine
spiro[2.5]octan-8-amine (PubChem CID 55290527) has the molecular formula C8H15N
and a molecular weight of 125.22 g/mol. Its IUPAC name is spiro[2.5]octan-8-amine.
Molecular Properties
| Compound Name | spiro[2.5]octan-8-amine |
| PubChem CID | 55290527 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.22 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | spiro[2.5]octan-8-amine |
| SMILES | NC1CCCCC12CC2 |
| InChI | InChI=1S/C8H15N/c9-7-3-1-2-4-8(7)5-6-8/h7H,1-6,9H2 |
| InChIKey | WCSMCNIQVFJWAS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.22 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[2.5]octan-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[2.5]octan-8-amine?
The IUPAC name of spiro[2.5]octan-8-amine (CID 55290527) is spiro[2.5]octan-8-amine.
What is the SMILES notation for spiro[2.5]octan-8-amine?
The canonical SMILES for spiro[2.5]octan-8-amine is NC1CCCCC12CC2.
What is the InChIKey of spiro[2.5]octan-8-amine?
The InChIKey is WCSMCNIQVFJWAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N/c9-7-3-1-2-4-8(7)5-6-8/h7H,1-6,9H2.
What are the key properties of spiro[2.5]octan-8-amine?
spiro[2.5]octan-8-amine has a molecular weight of 125.22 g/mol, XLogP of 1.67, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[2.5]octan-8-amine is sourced from PubChem (CID 55290527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).