About [(E)-2,2-difluoroethylideneamino]urea
[(E)-2,2-difluoroethylideneamino]urea (PubChem CID 55290636) has the molecular formula C3H5F2N3O
and a molecular weight of 137.09 g/mol. Its IUPAC name is [(E)-2,2-difluoroethylideneamino]urea.
Molecular Properties
| Compound Name | [(E)-2,2-difluoroethylideneamino]urea |
| PubChem CID | 55290636 |
| Molecular Formula | C3H5F2N3O |
| Molecular Weight | 137.09 g/mol |
| Exact Mass | 137.04 |
| IUPAC Name | [(E)-2,2-difluoroethylideneamino]urea |
| SMILES | NC(=O)N/N=C/C(F)F |
| InChI | InChI=1S/C3H5F2N3O/c4-2(5)1-7-8-3(6)9/h1-2H,(H3,6,8,9)/b7-1+ |
| InChIKey | RTKOOTKCOGYKOO-LREOWRDNSA-N |
| XLogP | -0.09 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.09 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-2,2-difluoroethylideneamino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-2,2-difluoroethylideneamino]urea?
The IUPAC name of [(E)-2,2-difluoroethylideneamino]urea (CID 55290636) is [(E)-2,2-difluoroethylideneamino]urea.
What is the SMILES notation for [(E)-2,2-difluoroethylideneamino]urea?
The canonical SMILES for [(E)-2,2-difluoroethylideneamino]urea is NC(=O)N/N=C/C(F)F.
What is the InChIKey of [(E)-2,2-difluoroethylideneamino]urea?
The InChIKey is RTKOOTKCOGYKOO-LREOWRDNSA-N. The full InChI is InChI=1S/C3H5F2N3O/c4-2(5)1-7-8-3(6)9/h1-2H,(H3,6,8,9)/b7-1+.
What are the key properties of [(E)-2,2-difluoroethylideneamino]urea?
[(E)-2,2-difluoroethylideneamino]urea has a molecular weight of 137.09 g/mol, XLogP of -0.09, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-2,2-difluoroethylideneamino]urea is sourced from PubChem (CID 55290636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).