About diethylaminothiourea
diethylaminothiourea (PubChem CID 55290674) has the molecular formula C5H13N3S
and a molecular weight of 147.25 g/mol. Its IUPAC name is diethylaminothiourea.
Molecular Properties
| Compound Name | diethylaminothiourea |
| PubChem CID | 55290674 |
| Molecular Formula | C5H13N3S |
| Molecular Weight | 147.25 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | diethylaminothiourea |
| SMILES | CCN(CC)NC(N)=S |
| InChI | InChI=1S/C5H13N3S/c1-3-8(4-2)7-5(6)9/h3-4H2,1-2H3,(H3,6,7,9) |
| InChIKey | KJEXBOIIZJQKQE-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.25 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze diethylaminothiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethylaminothiourea?
The IUPAC name of diethylaminothiourea (CID 55290674) is diethylaminothiourea.
What is the SMILES notation for diethylaminothiourea?
The canonical SMILES for diethylaminothiourea is CCN(CC)NC(N)=S.
What is the InChIKey of diethylaminothiourea?
The InChIKey is KJEXBOIIZJQKQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3S/c1-3-8(4-2)7-5(6)9/h3-4H2,1-2H3,(H3,6,7,9).
What are the key properties of diethylaminothiourea?
diethylaminothiourea has a molecular weight of 147.25 g/mol, XLogP of 0.08, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diethylaminothiourea is sourced from PubChem (CID 55290674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).