About 2-imino-5-methyl-1,3-oxazolidine-3-carboximidamide
2-imino-5-methyl-1,3-oxazolidine-3-carboximidamide (PubChem CID 55290778) has the molecular formula C5H10N4O
and a molecular weight of 142.16 g/mol. Its IUPAC name is 2-imino-5-methyl-1,3-oxazolidine-3-carboximidamide.
Molecular Properties
| Compound Name | 2-imino-5-methyl-1,3-oxazolidine-3-carboximidamide |
| PubChem CID | 55290778 |
| Molecular Formula | C5H10N4O |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | 2-imino-5-methyl-1,3-oxazolidine-3-carboximidamide |
| SMILES | [H]/N=C1\OC(C)CN1/C(N)=N/[H] |
| InChI | InChI=1S/C5H10N4O/c1-3-2-9(4(6)7)5(8)10-3/h3,8H,2H2,1H3,(H3,6,7)/b8-5- |
| InChIKey | FDVOJUWIUDIHTL-YVMONPNESA-N |
| XLogP | -0.46 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-imino-5-methyl-1,3-oxazolidine-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imino-5-methyl-1,3-oxazolidine-3-carboximidamide?
The IUPAC name of 2-imino-5-methyl-1,3-oxazolidine-3-carboximidamide (CID 55290778) is 2-imino-5-methyl-1,3-oxazolidine-3-carboximidamide.
What is the SMILES notation for 2-imino-5-methyl-1,3-oxazolidine-3-carboximidamide?
The canonical SMILES for 2-imino-5-methyl-1,3-oxazolidine-3-carboximidamide is [H]/N=C1\OC(C)CN1/C(N)=N/[H].
What is the InChIKey of 2-imino-5-methyl-1,3-oxazolidine-3-carboximidamide?
The InChIKey is FDVOJUWIUDIHTL-YVMONPNESA-N. The full InChI is InChI=1S/C5H10N4O/c1-3-2-9(4(6)7)5(8)10-3/h3,8H,2H2,1H3,(H3,6,7)/b8-5-.
What are the key properties of 2-imino-5-methyl-1,3-oxazolidine-3-carboximidamide?
2-imino-5-methyl-1,3-oxazolidine-3-carboximidamide has a molecular weight of 142.16 g/mol, XLogP of -0.46, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imino-5-methyl-1,3-oxazolidine-3-carboximidamide is sourced from PubChem (CID 55290778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).