About 4-aminobicyclo[4.2.0]octa-1,3,5-trien-3-ol
4-aminobicyclo[4.2.0]octa-1,3,5-trien-3-ol (PubChem CID 55290844) has the molecular formula C8H9NO
and a molecular weight of 135.17 g/mol. Its IUPAC name is 4-aminobicyclo[4.2.0]octa-1,3,5-trien-3-ol.
Molecular Properties
| Compound Name | 4-aminobicyclo[4.2.0]octa-1,3,5-trien-3-ol |
| PubChem CID | 55290844 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 4-aminobicyclo[4.2.0]octa-1,3,5-trien-3-ol |
| SMILES | Nc1cc2c(cc1O)CC2 |
| InChI | InChI=1S/C8H9NO/c9-7-3-5-1-2-6(5)4-8(7)10/h3-4,10H,1-2,9H2 |
| InChIKey | NJJXXQOISMMCDB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobicyclo[4.2.0]octa-1,3,5-trien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobicyclo[4.2.0]octa-1,3,5-trien-3-ol?
The IUPAC name of 4-aminobicyclo[4.2.0]octa-1,3,5-trien-3-ol (CID 55290844) is 4-aminobicyclo[4.2.0]octa-1,3,5-trien-3-ol.
What is the SMILES notation for 4-aminobicyclo[4.2.0]octa-1,3,5-trien-3-ol?
The canonical SMILES for 4-aminobicyclo[4.2.0]octa-1,3,5-trien-3-ol is Nc1cc2c(cc1O)CC2.
What is the InChIKey of 4-aminobicyclo[4.2.0]octa-1,3,5-trien-3-ol?
The InChIKey is NJJXXQOISMMCDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO/c9-7-3-5-1-2-6(5)4-8(7)10/h3-4,10H,1-2,9H2.
What are the key properties of 4-aminobicyclo[4.2.0]octa-1,3,5-trien-3-ol?
4-aminobicyclo[4.2.0]octa-1,3,5-trien-3-ol has a molecular weight of 135.17 g/mol, XLogP of 1.07, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobicyclo[4.2.0]octa-1,3,5-trien-3-ol is sourced from PubChem (CID 55290844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).