C5H10N2O3 — CID 55290895
(3R,4R,5S)-3,4-diamino-5-(hydroxymethyl)oxolan-2-one (PubChem CID 55290895) has the molecular formula C5H10N2O3 and a molecular weight of 146.15 g/mol. Its IUPAC name is (3R,4R,5S)-3,4-diamino-5-(hydroxymethyl)oxolan-2-one.
| Compound Name | (3R,4R,5S)-3,4-diamino-5-(hydroxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 55290895 |
| Molecular Formula | C5H10N2O3 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | (3R,4R,5S)-3,4-diamino-5-(hydroxymethyl)oxolan-2-one |
| SMILES | N[C@H]1[C@@H](CO)OC(=O)[C@@H]1N |
| InChI | InChI=1S/C5H10N2O3/c6-3-2(1-8)10-5(9)4(3)7/h2-4,8H,1,6-7H2/t2-,3+,4-/m1/s1 |
| InChIKey | PIFLQYVPSWOGAA-FLRLBIABSA-N |
| XLogP | -2.44 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |