C6H10N2O — CID 55291049
1,2,3,6-tetrahydropyridine-2-carboxamide (PubChem CID 55291049) has the molecular formula C6H10N2O and a molecular weight of 126.16 g/mol. Its IUPAC name is 1,2,3,6-tetrahydropyridine-2-carboxamide.
| Compound Name | 1,2,3,6-tetrahydropyridine-2-carboxamide |
|---|---|
| PubChem CID | 55291049 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 1,2,3,6-tetrahydropyridine-2-carboxamide |
| SMILES | NC(=O)C1CC=CCN1 |
| InChI | InChI=1S/C6H10N2O/c7-6(9)5-3-1-2-4-8-5/h1-2,5,8H,3-4H2,(H2,7,9) |
| InChIKey | LDQIHKHZZYNHPX-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|