About 4-amino-3-ethyl-1,4-dihydropyrimidin-2-one
4-amino-3-ethyl-1,4-dihydropyrimidin-2-one (PubChem CID 55291156) has the molecular formula C6H11N3O
and a molecular weight of 141.17 g/mol. Its IUPAC name is 4-amino-3-ethyl-1,4-dihydropyrimidin-2-one.
Molecular Properties
| Compound Name | 4-amino-3-ethyl-1,4-dihydropyrimidin-2-one |
| PubChem CID | 55291156 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | 4-amino-3-ethyl-1,4-dihydropyrimidin-2-one |
| SMILES | CCN1C(=O)NC=CC1N |
| InChI | InChI=1S/C6H11N3O/c1-2-9-5(7)3-4-8-6(9)10/h3-5H,2,7H2,1H3,(H,8,10) |
| InChIKey | ZSXLEUDWHWPKSJ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-amino-3-ethyl-1,4-dihydropyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-ethyl-1,4-dihydropyrimidin-2-one?
The IUPAC name of 4-amino-3-ethyl-1,4-dihydropyrimidin-2-one (CID 55291156) is 4-amino-3-ethyl-1,4-dihydropyrimidin-2-one.
What is the SMILES notation for 4-amino-3-ethyl-1,4-dihydropyrimidin-2-one?
The canonical SMILES for 4-amino-3-ethyl-1,4-dihydropyrimidin-2-one is CCN1C(=O)NC=CC1N.
What is the InChIKey of 4-amino-3-ethyl-1,4-dihydropyrimidin-2-one?
The InChIKey is ZSXLEUDWHWPKSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O/c1-2-9-5(7)3-4-8-6(9)10/h3-5H,2,7H2,1H3,(H,8,10).
What are the key properties of 4-amino-3-ethyl-1,4-dihydropyrimidin-2-one?
4-amino-3-ethyl-1,4-dihydropyrimidin-2-one has a molecular weight of 141.17 g/mol, XLogP of -0.17, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-ethyl-1,4-dihydropyrimidin-2-one is sourced from PubChem (CID 55291156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).