About 3-amino-4-hydroxy-N,N-dimethylbutanamide
3-amino-4-hydroxy-N,N-dimethylbutanamide (PubChem CID 55291263) has the molecular formula C6H14N2O2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 3-amino-4-hydroxy-N,N-dimethylbutanamide.
Molecular Properties
| Compound Name | 3-amino-4-hydroxy-N,N-dimethylbutanamide |
| PubChem CID | 55291263 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 3-amino-4-hydroxy-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CC(N)CO |
| InChI | InChI=1S/C6H14N2O2/c1-8(2)6(10)3-5(7)4-9/h5,9H,3-4,7H2,1-2H3 |
| InChIKey | KTVIAXLDQKQVGI-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-4-hydroxy-N,N-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-hydroxy-N,N-dimethylbutanamide?
The IUPAC name of 3-amino-4-hydroxy-N,N-dimethylbutanamide (CID 55291263) is 3-amino-4-hydroxy-N,N-dimethylbutanamide.
What is the SMILES notation for 3-amino-4-hydroxy-N,N-dimethylbutanamide?
The canonical SMILES for 3-amino-4-hydroxy-N,N-dimethylbutanamide is CN(C)C(=O)CC(N)CO.
What is the InChIKey of 3-amino-4-hydroxy-N,N-dimethylbutanamide?
The InChIKey is KTVIAXLDQKQVGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O2/c1-8(2)6(10)3-5(7)4-9/h5,9H,3-4,7H2,1-2H3.
What are the key properties of 3-amino-4-hydroxy-N,N-dimethylbutanamide?
3-amino-4-hydroxy-N,N-dimethylbutanamide has a molecular weight of 146.19 g/mol, XLogP of -1.22, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-hydroxy-N,N-dimethylbutanamide is sourced from PubChem (CID 55291263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).