About hex-5-enylurea
hex-5-enylurea (PubChem CID 55291393) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is hex-5-enylurea.
Molecular Properties
| Compound Name | hex-5-enylurea |
| PubChem CID | 55291393 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | hex-5-enylurea |
| SMILES | C=CCCCCNC(N)=O |
| InChI | InChI=1S/C7H14N2O/c1-2-3-4-5-6-9-7(8)10/h2H,1,3-6H2,(H3,8,9,10) |
| InChIKey | BEZPATQLDHDKKC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hex-5-enylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-5-enylurea?
The IUPAC name of hex-5-enylurea (CID 55291393) is hex-5-enylurea.
What is the SMILES notation for hex-5-enylurea?
The canonical SMILES for hex-5-enylurea is C=CCCCCNC(N)=O.
What is the InChIKey of hex-5-enylurea?
The InChIKey is BEZPATQLDHDKKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O/c1-2-3-4-5-6-9-7(8)10/h2H,1,3-6H2,(H3,8,9,10).
What are the key properties of hex-5-enylurea?
hex-5-enylurea has a molecular weight of 142.20 g/mol, XLogP of 1.01, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hex-5-enylurea is sourced from PubChem (CID 55291393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).