About (2S,3R)-2-aminopent-4-ene-1,3-diol
(2S,3R)-2-aminopent-4-ene-1,3-diol (PubChem CID 55291498) has the molecular formula C5H11NO2
and a molecular weight of 117.15 g/mol. Its IUPAC name is (2S,3R)-2-aminopent-4-ene-1,3-diol.
Molecular Properties
| Compound Name | (2S,3R)-2-aminopent-4-ene-1,3-diol |
| PubChem CID | 55291498 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | (2S,3R)-2-aminopent-4-ene-1,3-diol |
| SMILES | C=C[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C5H11NO2/c1-2-5(8)4(6)3-7/h2,4-5,7-8H,1,3,6H2/t4-,5+/m0/s1 |
| InChIKey | YYAPFWJOYCVYIV-CRCLSJGQSA-N |
| XLogP | -1.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S,3R)-2-aminopent-4-ene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-2-aminopent-4-ene-1,3-diol?
The IUPAC name of (2S,3R)-2-aminopent-4-ene-1,3-diol (CID 55291498) is (2S,3R)-2-aminopent-4-ene-1,3-diol.
What is the SMILES notation for (2S,3R)-2-aminopent-4-ene-1,3-diol?
The canonical SMILES for (2S,3R)-2-aminopent-4-ene-1,3-diol is C=C[C@@H](O)[C@@H](N)CO.
What is the InChIKey of (2S,3R)-2-aminopent-4-ene-1,3-diol?
The InChIKey is YYAPFWJOYCVYIV-CRCLSJGQSA-N. The full InChI is InChI=1S/C5H11NO2/c1-2-5(8)4(6)3-7/h2,4-5,7-8H,1,3,6H2/t4-,5+/m0/s1.
What are the key properties of (2S,3R)-2-aminopent-4-ene-1,3-diol?
(2S,3R)-2-aminopent-4-ene-1,3-diol has a molecular weight of 117.15 g/mol, XLogP of -1.15, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-2-aminopent-4-ene-1,3-diol is sourced from PubChem (CID 55291498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).