About (3S,4R)-3,4-diaminopyrrolidin-2-one
(3S,4R)-3,4-diaminopyrrolidin-2-one (PubChem CID 55291509) has the molecular formula C4H9N3O
and a molecular weight of 115.14 g/mol. Its IUPAC name is (3S,4R)-3,4-diaminopyrrolidin-2-one.
Molecular Properties
| Compound Name | (3S,4R)-3,4-diaminopyrrolidin-2-one |
| PubChem CID | 55291509 |
| Molecular Formula | C4H9N3O |
| Molecular Weight | 115.14 g/mol |
| Exact Mass | 115.07 |
| IUPAC Name | (3S,4R)-3,4-diaminopyrrolidin-2-one |
| SMILES | N[C@@H]1CNC(=O)[C@H]1N |
| InChI | InChI=1S/C4H9N3O/c5-2-1-7-4(8)3(2)6/h2-3H,1,5-6H2,(H,7,8)/t2-,3+/m1/s1 |
| InChIKey | MKMQQCPYKCENHE-GBXIJSLDSA-N |
| XLogP | -2.23 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.14 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,4R)-3,4-diaminopyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-3,4-diaminopyrrolidin-2-one?
The IUPAC name of (3S,4R)-3,4-diaminopyrrolidin-2-one (CID 55291509) is (3S,4R)-3,4-diaminopyrrolidin-2-one.
What is the SMILES notation for (3S,4R)-3,4-diaminopyrrolidin-2-one?
The canonical SMILES for (3S,4R)-3,4-diaminopyrrolidin-2-one is N[C@@H]1CNC(=O)[C@H]1N.
What is the InChIKey of (3S,4R)-3,4-diaminopyrrolidin-2-one?
The InChIKey is MKMQQCPYKCENHE-GBXIJSLDSA-N. The full InChI is InChI=1S/C4H9N3O/c5-2-1-7-4(8)3(2)6/h2-3H,1,5-6H2,(H,7,8)/t2-,3+/m1/s1.
What are the key properties of (3S,4R)-3,4-diaminopyrrolidin-2-one?
(3S,4R)-3,4-diaminopyrrolidin-2-one has a molecular weight of 115.14 g/mol, XLogP of -2.23, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-3,4-diaminopyrrolidin-2-one is sourced from PubChem (CID 55291509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).