C5H11N5 — CID 55291531
2-(1,4,5,6-tetrahydropyrimidin-2-yl)guanidine (PubChem CID 55291531) has the molecular formula C5H11N5 and a molecular weight of 141.18 g/mol. Its IUPAC name is 2-(1,4,5,6-tetrahydropyrimidin-2-yl)guanidine.
| Compound Name | 2-(1,4,5,6-tetrahydropyrimidin-2-yl)guanidine |
|---|---|
| PubChem CID | 55291531 |
| Molecular Formula | C5H11N5 |
| Molecular Weight | 141.18 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | 2-(1,4,5,6-tetrahydropyrimidin-2-yl)guanidine |
| SMILES | NC(N)=NC1=NCCCN1 |
| InChI | InChI=1S/C5H11N5/c6-4(7)10-5-8-2-1-3-9-5/h1-3H2,(H5,6,7,8,9,10) |
| InChIKey | YWJMSABIIUPHRO-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.18 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|