C12H17N — CID 55291712
5,7-dimethyl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 55291712) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is 5,7-dimethyl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 5,7-dimethyl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 55291712 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 5,7-dimethyl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | Cc1cc(C)c2c(c1)CC(N)CC2 |
| InChI | InChI=1S/C12H17N/c1-8-5-9(2)12-4-3-11(13)7-10(12)6-8/h5-6,11H,3-4,7,13H2,1-2H3 |
| InChIKey | BJKKYYCINNPGGG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |