C19H42O4Si2 — CID 552918
1,3-bis(trimethylsilyloxy)propan-2-yl decanoate (PubChem CID 552918) has the molecular formula C19H42O4Si2 and a molecular weight of 390.71 g/mol. Its IUPAC name is 1,3-bis(trimethylsilyloxy)propan-2-yl decanoate.
| Compound Name | 1,3-bis(trimethylsilyloxy)propan-2-yl decanoate |
|---|---|
| PubChem CID | 552918 |
| Molecular Formula | C19H42O4Si2 |
| Molecular Weight | 390.71 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | 1,3-bis(trimethylsilyloxy)propan-2-yl decanoate |
| SMILES | CCCCCCCCCC(=O)OC(CO[Si](C)(C)C)CO[Si](C)(C)C |
| InChI | InChI=1S/C19H42O4Si2/c1-8-9-10-11-12-13-14-15-19(20)23-18(16-21-24(2,3)4)17-22-25(5,6)7/h18H,8-17H2,1-7H3 |
| InChIKey | STBQJQZMNVLJEL-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.71 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|