About 1-amino-4-fluoro-2,3-dihydro-1H-indene-5-carbonitrile
1-amino-4-fluoro-2,3-dihydro-1H-indene-5-carbonitrile (PubChem CID 55292008) has the molecular formula C10H9FN2
and a molecular weight of 176.19 g/mol. Its IUPAC name is 1-amino-4-fluoro-2,3-dihydro-1H-indene-5-carbonitrile.
Molecular Properties
| Compound Name | 1-amino-4-fluoro-2,3-dihydro-1H-indene-5-carbonitrile |
| PubChem CID | 55292008 |
| Molecular Formula | C10H9FN2 |
| Molecular Weight | 176.19 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 1-amino-4-fluoro-2,3-dihydro-1H-indene-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1F)CCC2N |
| InChI | InChI=1S/C10H9FN2/c11-10-6(5-12)1-2-7-8(10)3-4-9(7)13/h1-2,9H,3-4,13H2 |
| InChIKey | WHGSMVJCVBFDCG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.19 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-amino-4-fluoro-2,3-dihydro-1H-indene-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-4-fluoro-2,3-dihydro-1H-indene-5-carbonitrile?
The IUPAC name of 1-amino-4-fluoro-2,3-dihydro-1H-indene-5-carbonitrile (CID 55292008) is 1-amino-4-fluoro-2,3-dihydro-1H-indene-5-carbonitrile.
What is the SMILES notation for 1-amino-4-fluoro-2,3-dihydro-1H-indene-5-carbonitrile?
The canonical SMILES for 1-amino-4-fluoro-2,3-dihydro-1H-indene-5-carbonitrile is N#Cc1ccc2c(c1F)CCC2N.
What is the InChIKey of 1-amino-4-fluoro-2,3-dihydro-1H-indene-5-carbonitrile?
The InChIKey is WHGSMVJCVBFDCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FN2/c11-10-6(5-12)1-2-7-8(10)3-4-9(7)13/h1-2,9H,3-4,13H2.
What are the key properties of 1-amino-4-fluoro-2,3-dihydro-1H-indene-5-carbonitrile?
1-amino-4-fluoro-2,3-dihydro-1H-indene-5-carbonitrile has a molecular weight of 176.19 g/mol, XLogP of 1.64, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-4-fluoro-2,3-dihydro-1H-indene-5-carbonitrile is sourced from PubChem (CID 55292008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).