About 3-amino-5-methoxy-2,3-dihydro-1-benzofuran-6-ol
3-amino-5-methoxy-2,3-dihydro-1-benzofuran-6-ol (PubChem CID 55292013) has the molecular formula C9H11NO3
and a molecular weight of 181.19 g/mol. Its IUPAC name is 3-amino-5-methoxy-2,3-dihydro-1-benzofuran-6-ol.
Molecular Properties
| Compound Name | 3-amino-5-methoxy-2,3-dihydro-1-benzofuran-6-ol |
| PubChem CID | 55292013 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 3-amino-5-methoxy-2,3-dihydro-1-benzofuran-6-ol |
| SMILES | COc1cc2c(cc1O)OCC2N |
| InChI | InChI=1S/C9H11NO3/c1-12-9-2-5-6(10)4-13-8(5)3-7(9)11/h2-3,6,11H,4,10H2,1H3 |
| InChIKey | QUWYHALJSUBOJG-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-5-methoxy-2,3-dihydro-1-benzofuran-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-methoxy-2,3-dihydro-1-benzofuran-6-ol?
The IUPAC name of 3-amino-5-methoxy-2,3-dihydro-1-benzofuran-6-ol (CID 55292013) is 3-amino-5-methoxy-2,3-dihydro-1-benzofuran-6-ol.
What is the SMILES notation for 3-amino-5-methoxy-2,3-dihydro-1-benzofuran-6-ol?
The canonical SMILES for 3-amino-5-methoxy-2,3-dihydro-1-benzofuran-6-ol is COc1cc2c(cc1O)OCC2N.
What is the InChIKey of 3-amino-5-methoxy-2,3-dihydro-1-benzofuran-6-ol?
The InChIKey is QUWYHALJSUBOJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3/c1-12-9-2-5-6(10)4-13-8(5)3-7(9)11/h2-3,6,11H,4,10H2,1H3.
What are the key properties of 3-amino-5-methoxy-2,3-dihydro-1-benzofuran-6-ol?
3-amino-5-methoxy-2,3-dihydro-1-benzofuran-6-ol has a molecular weight of 181.19 g/mol, XLogP of 0.79, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-methoxy-2,3-dihydro-1-benzofuran-6-ol is sourced from PubChem (CID 55292013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).