About (1S)-1-(2,6-difluoro-3-pyridinyl)prop-2-en-1-amine
(1S)-1-(2,6-difluoro-3-pyridinyl)prop-2-en-1-amine (PubChem CID 55292187) has the molecular formula C8H8F2N2
and a molecular weight of 170.16 g/mol. Its IUPAC name is (1S)-1-(2,6-difluoro-3-pyridinyl)prop-2-en-1-amine.
Molecular Properties
| Compound Name | (1S)-1-(2,6-difluoro-3-pyridinyl)prop-2-en-1-amine |
| PubChem CID | 55292187 |
| Molecular Formula | C8H8F2N2 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | (1S)-1-(2,6-difluoro-3-pyridinyl)prop-2-en-1-amine |
| SMILES | C=C[C@H](N)c1ccc(F)nc1F |
| InChI | InChI=1S/C8H8F2N2/c1-2-6(11)5-3-4-7(9)12-8(5)10/h2-4,6H,1,11H2/t6-/m0/s1 |
| InChIKey | MZGLUKLLXXZDSZ-LURJTMIESA-N |
| XLogP | 1.55 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-(2,6-difluoro-3-pyridinyl)prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(2,6-difluoro-3-pyridinyl)prop-2-en-1-amine?
The IUPAC name of (1S)-1-(2,6-difluoro-3-pyridinyl)prop-2-en-1-amine (CID 55292187) is (1S)-1-(2,6-difluoro-3-pyridinyl)prop-2-en-1-amine.
What is the SMILES notation for (1S)-1-(2,6-difluoro-3-pyridinyl)prop-2-en-1-amine?
The canonical SMILES for (1S)-1-(2,6-difluoro-3-pyridinyl)prop-2-en-1-amine is C=C[C@H](N)c1ccc(F)nc1F.
What is the InChIKey of (1S)-1-(2,6-difluoro-3-pyridinyl)prop-2-en-1-amine?
The InChIKey is MZGLUKLLXXZDSZ-LURJTMIESA-N. The full InChI is InChI=1S/C8H8F2N2/c1-2-6(11)5-3-4-7(9)12-8(5)10/h2-4,6H,1,11H2/t6-/m0/s1.
What are the key properties of (1S)-1-(2,6-difluoro-3-pyridinyl)prop-2-en-1-amine?
(1S)-1-(2,6-difluoro-3-pyridinyl)prop-2-en-1-amine has a molecular weight of 170.16 g/mol, XLogP of 1.55, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(2,6-difluoro-3-pyridinyl)prop-2-en-1-amine is sourced from PubChem (CID 55292187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).