About 3-[(1R)-1,2-diaminoethyl]-1H-pyridine-2-thione
3-[(1R)-1,2-diaminoethyl]-1H-pyridine-2-thione (PubChem CID 55292749) has the molecular formula C7H11N3S
and a molecular weight of 169.25 g/mol. Its IUPAC name is 3-[(1R)-1,2-diaminoethyl]-1H-pyridine-2-thione.
Molecular Properties
| Compound Name | 3-[(1R)-1,2-diaminoethyl]-1H-pyridine-2-thione |
| PubChem CID | 55292749 |
| Molecular Formula | C7H11N3S |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 3-[(1R)-1,2-diaminoethyl]-1H-pyridine-2-thione |
| SMILES | NC[C@H](N)c1ccc[nH]c1=S |
| InChI | InChI=1S/C7H11N3S/c8-4-6(9)5-2-1-3-10-7(5)11/h1-3,6H,4,8-9H2,(H,10,11)/t6-/m0/s1 |
| InChIKey | UOBPUBITZBBVHW-LURJTMIESA-N |
| XLogP | 0.70 |
| TPSA | 67.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1R)-1,2-diaminoethyl]-1H-pyridine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1R)-1,2-diaminoethyl]-1H-pyridine-2-thione?
The IUPAC name of 3-[(1R)-1,2-diaminoethyl]-1H-pyridine-2-thione (CID 55292749) is 3-[(1R)-1,2-diaminoethyl]-1H-pyridine-2-thione.
What is the SMILES notation for 3-[(1R)-1,2-diaminoethyl]-1H-pyridine-2-thione?
The canonical SMILES for 3-[(1R)-1,2-diaminoethyl]-1H-pyridine-2-thione is NC[C@H](N)c1ccc[nH]c1=S.
What is the InChIKey of 3-[(1R)-1,2-diaminoethyl]-1H-pyridine-2-thione?
The InChIKey is UOBPUBITZBBVHW-LURJTMIESA-N. The full InChI is InChI=1S/C7H11N3S/c8-4-6(9)5-2-1-3-10-7(5)11/h1-3,6H,4,8-9H2,(H,10,11)/t6-/m0/s1.
What are the key properties of 3-[(1R)-1,2-diaminoethyl]-1H-pyridine-2-thione?
3-[(1R)-1,2-diaminoethyl]-1H-pyridine-2-thione has a molecular weight of 169.25 g/mol, XLogP of 0.70, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R)-1,2-diaminoethyl]-1H-pyridine-2-thione is sourced from PubChem (CID 55292749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).