About (3S)-3-amino-6-fluoro-2,3-dihydro-1-benzofuran-7-ol
(3S)-3-amino-6-fluoro-2,3-dihydro-1-benzofuran-7-ol (PubChem CID 55292857) has the molecular formula C8H8FNO2
and a molecular weight of 169.16 g/mol. Its IUPAC name is (3S)-3-amino-6-fluoro-2,3-dihydro-1-benzofuran-7-ol.
Molecular Properties
| Compound Name | (3S)-3-amino-6-fluoro-2,3-dihydro-1-benzofuran-7-ol |
| PubChem CID | 55292857 |
| Molecular Formula | C8H8FNO2 |
| Molecular Weight | 169.16 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | (3S)-3-amino-6-fluoro-2,3-dihydro-1-benzofuran-7-ol |
| SMILES | N[C@@H]1COc2c1ccc(F)c2O |
| InChI | InChI=1S/C8H8FNO2/c9-5-2-1-4-6(10)3-12-8(4)7(5)11/h1-2,6,11H,3,10H2/t6-/m1/s1 |
| InChIKey | OTBRCPVAZCJHHC-ZCFIWIBFSA-N |
| XLogP | 0.92 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.16 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-amino-6-fluoro-2,3-dihydro-1-benzofuran-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-amino-6-fluoro-2,3-dihydro-1-benzofuran-7-ol?
The IUPAC name of (3S)-3-amino-6-fluoro-2,3-dihydro-1-benzofuran-7-ol (CID 55292857) is (3S)-3-amino-6-fluoro-2,3-dihydro-1-benzofuran-7-ol.
What is the SMILES notation for (3S)-3-amino-6-fluoro-2,3-dihydro-1-benzofuran-7-ol?
The canonical SMILES for (3S)-3-amino-6-fluoro-2,3-dihydro-1-benzofuran-7-ol is N[C@@H]1COc2c1ccc(F)c2O.
What is the InChIKey of (3S)-3-amino-6-fluoro-2,3-dihydro-1-benzofuran-7-ol?
The InChIKey is OTBRCPVAZCJHHC-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H8FNO2/c9-5-2-1-4-6(10)3-12-8(4)7(5)11/h1-2,6,11H,3,10H2/t6-/m1/s1.
What are the key properties of (3S)-3-amino-6-fluoro-2,3-dihydro-1-benzofuran-7-ol?
(3S)-3-amino-6-fluoro-2,3-dihydro-1-benzofuran-7-ol has a molecular weight of 169.16 g/mol, XLogP of 0.92, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-amino-6-fluoro-2,3-dihydro-1-benzofuran-7-ol is sourced from PubChem (CID 55292857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).