About (3S)-7-chloro-2,3-dihydro-1-benzofuran-3,6-diamine
(3S)-7-chloro-2,3-dihydro-1-benzofuran-3,6-diamine (PubChem CID 55293145) has the molecular formula C8H9ClN2O
and a molecular weight of 184.63 g/mol. Its IUPAC name is (3S)-7-chloro-2,3-dihydro-1-benzofuran-3,6-diamine.
Molecular Properties
| Compound Name | (3S)-7-chloro-2,3-dihydro-1-benzofuran-3,6-diamine |
| PubChem CID | 55293145 |
| Molecular Formula | C8H9ClN2O |
| Molecular Weight | 184.63 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | (3S)-7-chloro-2,3-dihydro-1-benzofuran-3,6-diamine |
| SMILES | Nc1ccc2c(c1Cl)OC[C@H]2N |
| InChI | InChI=1S/C8H9ClN2O/c9-7-5(10)2-1-4-6(11)3-12-8(4)7/h1-2,6H,3,10-11H2/t6-/m1/s1 |
| InChIKey | HSKYJJYQURLHQK-ZCFIWIBFSA-N |
| XLogP | 1.31 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.63 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (3S)-7-chloro-2,3-dihydro-1-benzofuran-3,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-7-chloro-2,3-dihydro-1-benzofuran-3,6-diamine?
The IUPAC name of (3S)-7-chloro-2,3-dihydro-1-benzofuran-3,6-diamine (CID 55293145) is (3S)-7-chloro-2,3-dihydro-1-benzofuran-3,6-diamine.
What is the SMILES notation for (3S)-7-chloro-2,3-dihydro-1-benzofuran-3,6-diamine?
The canonical SMILES for (3S)-7-chloro-2,3-dihydro-1-benzofuran-3,6-diamine is Nc1ccc2c(c1Cl)OC[C@H]2N.
What is the InChIKey of (3S)-7-chloro-2,3-dihydro-1-benzofuran-3,6-diamine?
The InChIKey is HSKYJJYQURLHQK-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H9ClN2O/c9-7-5(10)2-1-4-6(11)3-12-8(4)7/h1-2,6H,3,10-11H2/t6-/m1/s1.
What are the key properties of (3S)-7-chloro-2,3-dihydro-1-benzofuran-3,6-diamine?
(3S)-7-chloro-2,3-dihydro-1-benzofuran-3,6-diamine has a molecular weight of 184.63 g/mol, XLogP of 1.31, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-7-chloro-2,3-dihydro-1-benzofuran-3,6-diamine is sourced from PubChem (CID 55293145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).