About (7R)-8,9-dihydro-7H-cyclopenta[f]quinolin-7-amine
(7R)-8,9-dihydro-7H-cyclopenta[f]quinolin-7-amine (PubChem CID 55293433) has the molecular formula C12H12N2
and a molecular weight of 184.24 g/mol. Its IUPAC name is (7R)-8,9-dihydro-7H-cyclopenta[f]quinolin-7-amine.
Molecular Properties
| Compound Name | (7R)-8,9-dihydro-7H-cyclopenta[f]quinolin-7-amine |
| PubChem CID | 55293433 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | (7R)-8,9-dihydro-7H-cyclopenta[f]quinolin-7-amine |
| SMILES | N[C@@H]1CCc2c1ccc1ncccc21 |
| InChI | InChI=1S/C12H12N2/c13-11-5-3-8-9(11)4-6-12-10(8)2-1-7-14-12/h1-2,4,6-7,11H,3,5,13H2/t11-/m1/s1 |
| InChIKey | UBWPMQPIBPRFDO-LLVKDONJSA-N |
| XLogP | 2.18 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (7R)-8,9-dihydro-7H-cyclopenta[f]quinolin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-8,9-dihydro-7H-cyclopenta[f]quinolin-7-amine?
The IUPAC name of (7R)-8,9-dihydro-7H-cyclopenta[f]quinolin-7-amine (CID 55293433) is (7R)-8,9-dihydro-7H-cyclopenta[f]quinolin-7-amine.
What is the SMILES notation for (7R)-8,9-dihydro-7H-cyclopenta[f]quinolin-7-amine?
The canonical SMILES for (7R)-8,9-dihydro-7H-cyclopenta[f]quinolin-7-amine is N[C@@H]1CCc2c1ccc1ncccc21.
What is the InChIKey of (7R)-8,9-dihydro-7H-cyclopenta[f]quinolin-7-amine?
The InChIKey is UBWPMQPIBPRFDO-LLVKDONJSA-N. The full InChI is InChI=1S/C12H12N2/c13-11-5-3-8-9(11)4-6-12-10(8)2-1-7-14-12/h1-2,4,6-7,11H,3,5,13H2/t11-/m1/s1.
What are the key properties of (7R)-8,9-dihydro-7H-cyclopenta[f]quinolin-7-amine?
(7R)-8,9-dihydro-7H-cyclopenta[f]quinolin-7-amine has a molecular weight of 184.24 g/mol, XLogP of 2.18, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-8,9-dihydro-7H-cyclopenta[f]quinolin-7-amine is sourced from PubChem (CID 55293433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).