C10H10N2O — CID 55293450
3,5-dihydro-2H-furo[2,3-f]indol-3-amine (PubChem CID 55293450) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is 3,5-dihydro-2H-furo[2,3-f]indol-3-amine.
| Compound Name | 3,5-dihydro-2H-furo[2,3-f]indol-3-amine |
|---|---|
| PubChem CID | 55293450 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 3,5-dihydro-2H-furo[2,3-f]indol-3-amine |
| SMILES | NC1COc2cc3cc[nH]c3cc21 |
| InChI | InChI=1S/C10H10N2O/c11-8-5-13-10-3-6-1-2-12-9(6)4-7(8)10/h1-4,8,12H,5,11H2 |
| InChIKey | YKZCXWBZTNSOGS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |