C6H6F3N3 — CID 55293918
(1S)-2,2,2-trifluoro-1-pyrazin-2-ylethanamine (PubChem CID 55293918) has the molecular formula C6H6F3N3 and a molecular weight of 177.13 g/mol. Its IUPAC name is (1S)-2,2,2-trifluoro-1-pyrazin-2-ylethanamine.
| Compound Name | (1S)-2,2,2-trifluoro-1-pyrazin-2-ylethanamine |
|---|---|
| PubChem CID | 55293918 |
| Molecular Formula | C6H6F3N3 |
| Molecular Weight | 177.13 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | (1S)-2,2,2-trifluoro-1-pyrazin-2-ylethanamine |
| SMILES | N[C@@H](c1cnccn1)C(F)(F)F |
| InChI | InChI=1S/C6H6F3N3/c7-6(8,9)5(10)4-3-11-1-2-12-4/h1-3,5H,10H2/t5-/m0/s1 |
| InChIKey | MNZVSCKKSJEFKM-YFKPBYRVSA-N |
| XLogP | 1.04 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.13 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |