About 6-fluoro-8-methyl-3,4-dihydro-2H-chromen-4-amine
6-fluoro-8-methyl-3,4-dihydro-2H-chromen-4-amine (PubChem CID 55293947) has the molecular formula C10H12FNO
and a molecular weight of 181.21 g/mol. Its IUPAC name is 6-fluoro-8-methyl-3,4-dihydro-2H-chromen-4-amine.
Molecular Properties
| Compound Name | 6-fluoro-8-methyl-3,4-dihydro-2H-chromen-4-amine |
| PubChem CID | 55293947 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 6-fluoro-8-methyl-3,4-dihydro-2H-chromen-4-amine |
| SMILES | Cc1cc(F)cc2c1OCCC2N |
| InChI | InChI=1S/C10H12FNO/c1-6-4-7(11)5-8-9(12)2-3-13-10(6)8/h4-5,9H,2-3,12H2,1H3 |
| InChIKey | LQYPVZGJJRSKMC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluoro-8-methyl-3,4-dihydro-2H-chromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-8-methyl-3,4-dihydro-2H-chromen-4-amine?
The IUPAC name of 6-fluoro-8-methyl-3,4-dihydro-2H-chromen-4-amine (CID 55293947) is 6-fluoro-8-methyl-3,4-dihydro-2H-chromen-4-amine.
What is the SMILES notation for 6-fluoro-8-methyl-3,4-dihydro-2H-chromen-4-amine?
The canonical SMILES for 6-fluoro-8-methyl-3,4-dihydro-2H-chromen-4-amine is Cc1cc(F)cc2c1OCCC2N.
What is the InChIKey of 6-fluoro-8-methyl-3,4-dihydro-2H-chromen-4-amine?
The InChIKey is LQYPVZGJJRSKMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FNO/c1-6-4-7(11)5-8-9(12)2-3-13-10(6)8/h4-5,9H,2-3,12H2,1H3.
What are the key properties of 6-fluoro-8-methyl-3,4-dihydro-2H-chromen-4-amine?
6-fluoro-8-methyl-3,4-dihydro-2H-chromen-4-amine has a molecular weight of 181.21 g/mol, XLogP of 1.92, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-8-methyl-3,4-dihydro-2H-chromen-4-amine is sourced from PubChem (CID 55293947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).