About 6-[(1R,2S)-1-amino-2-hydroxypropyl]pyridine-3-carbonitrile
6-[(1R,2S)-1-amino-2-hydroxypropyl]pyridine-3-carbonitrile (PubChem CID 55294065) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is 6-[(1R,2S)-1-amino-2-hydroxypropyl]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-[(1R,2S)-1-amino-2-hydroxypropyl]pyridine-3-carbonitrile |
| PubChem CID | 55294065 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 6-[(1R,2S)-1-amino-2-hydroxypropyl]pyridine-3-carbonitrile |
| SMILES | C[C@H](O)[C@H](N)c1ccc(C#N)cn1 |
| InChI | InChI=1S/C9H11N3O/c1-6(13)9(11)8-3-2-7(4-10)5-12-8/h2-3,5-6,9,13H,11H2,1H3/t6-,9-/m0/s1 |
| InChIKey | DHHJPWBPSSTQTB-RCOVLWMOSA-N |
| XLogP | 0.33 |
| TPSA | 82.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[(1R,2S)-1-amino-2-hydroxypropyl]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(1R,2S)-1-amino-2-hydroxypropyl]pyridine-3-carbonitrile?
The IUPAC name of 6-[(1R,2S)-1-amino-2-hydroxypropyl]pyridine-3-carbonitrile (CID 55294065) is 6-[(1R,2S)-1-amino-2-hydroxypropyl]pyridine-3-carbonitrile.
What is the SMILES notation for 6-[(1R,2S)-1-amino-2-hydroxypropyl]pyridine-3-carbonitrile?
The canonical SMILES for 6-[(1R,2S)-1-amino-2-hydroxypropyl]pyridine-3-carbonitrile is C[C@H](O)[C@H](N)c1ccc(C#N)cn1.
What is the InChIKey of 6-[(1R,2S)-1-amino-2-hydroxypropyl]pyridine-3-carbonitrile?
The InChIKey is DHHJPWBPSSTQTB-RCOVLWMOSA-N. The full InChI is InChI=1S/C9H11N3O/c1-6(13)9(11)8-3-2-7(4-10)5-12-8/h2-3,5-6,9,13H,11H2,1H3/t6-,9-/m0/s1.
What are the key properties of 6-[(1R,2S)-1-amino-2-hydroxypropyl]pyridine-3-carbonitrile?
6-[(1R,2S)-1-amino-2-hydroxypropyl]pyridine-3-carbonitrile has a molecular weight of 177.21 g/mol, XLogP of 0.33, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(1R,2S)-1-amino-2-hydroxypropyl]pyridine-3-carbonitrile is sourced from PubChem (CID 55294065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).