About 1-(1H-pyrrolo[2,3-b]pyridin-5-yl)propan-1-amine
1-(1H-pyrrolo[2,3-b]pyridin-5-yl)propan-1-amine (PubChem CID 55294161) has the molecular formula C10H13N3
and a molecular weight of 175.24 g/mol. Its IUPAC name is 1-(1H-pyrrolo[2,3-b]pyridin-5-yl)propan-1-amine.
Molecular Properties
| Compound Name | 1-(1H-pyrrolo[2,3-b]pyridin-5-yl)propan-1-amine |
| PubChem CID | 55294161 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 1-(1H-pyrrolo[2,3-b]pyridin-5-yl)propan-1-amine |
| SMILES | CCC(N)c1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C10H13N3/c1-2-9(11)8-5-7-3-4-12-10(7)13-6-8/h3-6,9H,2,11H2,1H3,(H,12,13) |
| InChIKey | VKWUDSALNBCOQJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1H-pyrrolo[2,3-b]pyridin-5-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-pyrrolo[2,3-b]pyridin-5-yl)propan-1-amine?
The IUPAC name of 1-(1H-pyrrolo[2,3-b]pyridin-5-yl)propan-1-amine (CID 55294161) is 1-(1H-pyrrolo[2,3-b]pyridin-5-yl)propan-1-amine.
What is the SMILES notation for 1-(1H-pyrrolo[2,3-b]pyridin-5-yl)propan-1-amine?
The canonical SMILES for 1-(1H-pyrrolo[2,3-b]pyridin-5-yl)propan-1-amine is CCC(N)c1cnc2[nH]ccc2c1.
What is the InChIKey of 1-(1H-pyrrolo[2,3-b]pyridin-5-yl)propan-1-amine?
The InChIKey is VKWUDSALNBCOQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-2-9(11)8-5-7-3-4-12-10(7)13-6-8/h3-6,9H,2,11H2,1H3,(H,12,13).
What are the key properties of 1-(1H-pyrrolo[2,3-b]pyridin-5-yl)propan-1-amine?
1-(1H-pyrrolo[2,3-b]pyridin-5-yl)propan-1-amine has a molecular weight of 175.24 g/mol, XLogP of 1.97, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-pyrrolo[2,3-b]pyridin-5-yl)propan-1-amine is sourced from PubChem (CID 55294161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).