About 1-amino-1-(4,5-dimethylthiophen-2-yl)propan-2-one
1-amino-1-(4,5-dimethylthiophen-2-yl)propan-2-one (PubChem CID 55294713) has the molecular formula C9H13NOS
and a molecular weight of 183.28 g/mol. Its IUPAC name is 1-amino-1-(4,5-dimethylthiophen-2-yl)propan-2-one.
Molecular Properties
| Compound Name | 1-amino-1-(4,5-dimethylthiophen-2-yl)propan-2-one |
| PubChem CID | 55294713 |
| Molecular Formula | C9H13NOS |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 1-amino-1-(4,5-dimethylthiophen-2-yl)propan-2-one |
| SMILES | CC(=O)C(N)c1cc(C)c(C)s1 |
| InChI | InChI=1S/C9H13NOS/c1-5-4-8(12-7(5)3)9(10)6(2)11/h4,9H,10H2,1-3H3 |
| InChIKey | LAQKVJMJTXTVJL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-amino-1-(4,5-dimethylthiophen-2-yl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-1-(4,5-dimethylthiophen-2-yl)propan-2-one?
The IUPAC name of 1-amino-1-(4,5-dimethylthiophen-2-yl)propan-2-one (CID 55294713) is 1-amino-1-(4,5-dimethylthiophen-2-yl)propan-2-one.
What is the SMILES notation for 1-amino-1-(4,5-dimethylthiophen-2-yl)propan-2-one?
The canonical SMILES for 1-amino-1-(4,5-dimethylthiophen-2-yl)propan-2-one is CC(=O)C(N)c1cc(C)c(C)s1.
What is the InChIKey of 1-amino-1-(4,5-dimethylthiophen-2-yl)propan-2-one?
The InChIKey is LAQKVJMJTXTVJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NOS/c1-5-4-8(12-7(5)3)9(10)6(2)11/h4,9H,10H2,1-3H3.
What are the key properties of 1-amino-1-(4,5-dimethylthiophen-2-yl)propan-2-one?
1-amino-1-(4,5-dimethylthiophen-2-yl)propan-2-one has a molecular weight of 183.28 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-1-(4,5-dimethylthiophen-2-yl)propan-2-one is sourced from PubChem (CID 55294713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).