About 5-[(1R,2S)-1-amino-2-hydroxypropyl]-6-methyl-1H-pyridin-2-one
5-[(1R,2S)-1-amino-2-hydroxypropyl]-6-methyl-1H-pyridin-2-one (PubChem CID 55294913) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is 5-[(1R,2S)-1-amino-2-hydroxypropyl]-6-methyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 5-[(1R,2S)-1-amino-2-hydroxypropyl]-6-methyl-1H-pyridin-2-one |
| PubChem CID | 55294913 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 5-[(1R,2S)-1-amino-2-hydroxypropyl]-6-methyl-1H-pyridin-2-one |
| SMILES | Cc1[nH]c(=O)ccc1[C@@H](N)[C@H](C)O |
| InChI | InChI=1S/C9H14N2O2/c1-5-7(9(10)6(2)12)3-4-8(13)11-5/h3-4,6,9,12H,10H2,1-2H3,(H,11,13)/t6-,9-/m0/s1 |
| InChIKey | REFJLWOWRCPKJF-RCOVLWMOSA-N |
| XLogP | 0.06 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(1R,2S)-1-amino-2-hydroxypropyl]-6-methyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1R,2S)-1-amino-2-hydroxypropyl]-6-methyl-1H-pyridin-2-one?
The IUPAC name of 5-[(1R,2S)-1-amino-2-hydroxypropyl]-6-methyl-1H-pyridin-2-one (CID 55294913) is 5-[(1R,2S)-1-amino-2-hydroxypropyl]-6-methyl-1H-pyridin-2-one.
What is the SMILES notation for 5-[(1R,2S)-1-amino-2-hydroxypropyl]-6-methyl-1H-pyridin-2-one?
The canonical SMILES for 5-[(1R,2S)-1-amino-2-hydroxypropyl]-6-methyl-1H-pyridin-2-one is Cc1[nH]c(=O)ccc1[C@@H](N)[C@H](C)O.
What is the InChIKey of 5-[(1R,2S)-1-amino-2-hydroxypropyl]-6-methyl-1H-pyridin-2-one?
The InChIKey is REFJLWOWRCPKJF-RCOVLWMOSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-5-7(9(10)6(2)12)3-4-8(13)11-5/h3-4,6,9,12H,10H2,1-2H3,(H,11,13)/t6-,9-/m0/s1.
What are the key properties of 5-[(1R,2S)-1-amino-2-hydroxypropyl]-6-methyl-1H-pyridin-2-one?
5-[(1R,2S)-1-amino-2-hydroxypropyl]-6-methyl-1H-pyridin-2-one has a molecular weight of 182.22 g/mol, XLogP of 0.06, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1R,2S)-1-amino-2-hydroxypropyl]-6-methyl-1H-pyridin-2-one is sourced from PubChem (CID 55294913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).