About 4-amino-8-fluoro-3,4-dihydro-2H-chromen-6-ol
4-amino-8-fluoro-3,4-dihydro-2H-chromen-6-ol (PubChem CID 55294990) has the molecular formula C9H10FNO2
and a molecular weight of 183.18 g/mol. Its IUPAC name is 4-amino-8-fluoro-3,4-dihydro-2H-chromen-6-ol.
Molecular Properties
| Compound Name | 4-amino-8-fluoro-3,4-dihydro-2H-chromen-6-ol |
| PubChem CID | 55294990 |
| Molecular Formula | C9H10FNO2 |
| Molecular Weight | 183.18 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 4-amino-8-fluoro-3,4-dihydro-2H-chromen-6-ol |
| SMILES | NC1CCOc2c(F)cc(O)cc21 |
| InChI | InChI=1S/C9H10FNO2/c10-7-4-5(12)3-6-8(11)1-2-13-9(6)7/h3-4,8,12H,1-2,11H2 |
| InChIKey | BRQMPJXVWDEJBK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.18 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-8-fluoro-3,4-dihydro-2H-chromen-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-8-fluoro-3,4-dihydro-2H-chromen-6-ol?
The IUPAC name of 4-amino-8-fluoro-3,4-dihydro-2H-chromen-6-ol (CID 55294990) is 4-amino-8-fluoro-3,4-dihydro-2H-chromen-6-ol.
What is the SMILES notation for 4-amino-8-fluoro-3,4-dihydro-2H-chromen-6-ol?
The canonical SMILES for 4-amino-8-fluoro-3,4-dihydro-2H-chromen-6-ol is NC1CCOc2c(F)cc(O)cc21.
What is the InChIKey of 4-amino-8-fluoro-3,4-dihydro-2H-chromen-6-ol?
The InChIKey is BRQMPJXVWDEJBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FNO2/c10-7-4-5(12)3-6-8(11)1-2-13-9(6)7/h3-4,8,12H,1-2,11H2.
What are the key properties of 4-amino-8-fluoro-3,4-dihydro-2H-chromen-6-ol?
4-amino-8-fluoro-3,4-dihydro-2H-chromen-6-ol has a molecular weight of 183.18 g/mol, XLogP of 1.31, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-8-fluoro-3,4-dihydro-2H-chromen-6-ol is sourced from PubChem (CID 55294990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).