About 8-fluoro-3,4-dihydro-2H-chromene-4,7-diamine
8-fluoro-3,4-dihydro-2H-chromene-4,7-diamine (PubChem CID 55294993) has the molecular formula C9H11FN2O
and a molecular weight of 182.20 g/mol. Its IUPAC name is 8-fluoro-3,4-dihydro-2H-chromene-4,7-diamine.
Molecular Properties
| Compound Name | 8-fluoro-3,4-dihydro-2H-chromene-4,7-diamine |
| PubChem CID | 55294993 |
| Molecular Formula | C9H11FN2O |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 8-fluoro-3,4-dihydro-2H-chromene-4,7-diamine |
| SMILES | Nc1ccc2c(c1F)OCCC2N |
| InChI | InChI=1S/C9H11FN2O/c10-8-7(12)2-1-5-6(11)3-4-13-9(5)8/h1-2,6H,3-4,11-12H2 |
| InChIKey | ZBEVSHRDBPOGKL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 8-fluoro-3,4-dihydro-2H-chromene-4,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-3,4-dihydro-2H-chromene-4,7-diamine?
The IUPAC name of 8-fluoro-3,4-dihydro-2H-chromene-4,7-diamine (CID 55294993) is 8-fluoro-3,4-dihydro-2H-chromene-4,7-diamine.
What is the SMILES notation for 8-fluoro-3,4-dihydro-2H-chromene-4,7-diamine?
The canonical SMILES for 8-fluoro-3,4-dihydro-2H-chromene-4,7-diamine is Nc1ccc2c(c1F)OCCC2N.
What is the InChIKey of 8-fluoro-3,4-dihydro-2H-chromene-4,7-diamine?
The InChIKey is ZBEVSHRDBPOGKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN2O/c10-8-7(12)2-1-5-6(11)3-4-13-9(5)8/h1-2,6H,3-4,11-12H2.
What are the key properties of 8-fluoro-3,4-dihydro-2H-chromene-4,7-diamine?
8-fluoro-3,4-dihydro-2H-chromene-4,7-diamine has a molecular weight of 182.20 g/mol, XLogP of 1.19, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-3,4-dihydro-2H-chromene-4,7-diamine is sourced from PubChem (CID 55294993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).