C9H13NO3 — CID 55295292
4-[(1R,2S)-1-amino-2-hydroxypropyl]benzene-1,2-diol (PubChem CID 55295292) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 4-[(1R,2S)-1-amino-2-hydroxypropyl]benzene-1,2-diol.
| Compound Name | 4-[(1R,2S)-1-amino-2-hydroxypropyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 55295292 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 4-[(1R,2S)-1-amino-2-hydroxypropyl]benzene-1,2-diol |
| SMILES | C[C@H](O)[C@H](N)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H13NO3/c1-5(11)9(10)6-2-3-7(12)8(13)4-6/h2-5,9,11-13H,10H2,1H3/t5-,9-/m0/s1 |
| InChIKey | CZQITZBXRIORGE-CDUCUWFYSA-N |
| XLogP | 0.48 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|