C10H24S4Si2 — CID 552958
trimethyl-(8-trimethylsilyl-1,2,5,6-tetrathiocan-3-yl)silane (PubChem CID 552958) has the molecular formula C10H24S4Si2 and a molecular weight of 328.74 g/mol. Its IUPAC name is trimethyl-(8-trimethylsilyl-1,2,5,6-tetrathiocan-3-yl)silane.
| Compound Name | trimethyl-(8-trimethylsilyl-1,2,5,6-tetrathiocan-3-yl)silane |
|---|---|
| PubChem CID | 552958 |
| Molecular Formula | C10H24S4Si2 |
| Molecular Weight | 328.74 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | trimethyl-(8-trimethylsilyl-1,2,5,6-tetrathiocan-3-yl)silane |
| SMILES | C[Si](C)(C)C1CSSCC([Si](C)(C)C)SS1 |
| InChI | InChI=1S/C10H24S4Si2/c1-15(2,3)9-7-11-12-8-10(14-13-9)16(4,5)6/h9-10H,7-8H2,1-6H3 |
| InChIKey | VYODAYUZYAWPKQ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.74 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|