About 4-amino-1,1-dimethylfuro[3,4-c]pyridin-3-one
4-amino-1,1-dimethylfuro[3,4-c]pyridin-3-one (PubChem CID 55295877) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is 4-amino-1,1-dimethylfuro[3,4-c]pyridin-3-one.
Molecular Properties
| Compound Name | 4-amino-1,1-dimethylfuro[3,4-c]pyridin-3-one |
| PubChem CID | 55295877 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 4-amino-1,1-dimethylfuro[3,4-c]pyridin-3-one |
| SMILES | CC1(C)OC(=O)c2c1ccnc2N |
| InChI | InChI=1S/C9H10N2O2/c1-9(2)5-3-4-11-7(10)6(5)8(12)13-9/h3-4H,1-2H3,(H2,10,11) |
| InChIKey | BOUMCQBREOWUEE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-1,1-dimethylfuro[3,4-c]pyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1,1-dimethylfuro[3,4-c]pyridin-3-one?
The IUPAC name of 4-amino-1,1-dimethylfuro[3,4-c]pyridin-3-one (CID 55295877) is 4-amino-1,1-dimethylfuro[3,4-c]pyridin-3-one.
What is the SMILES notation for 4-amino-1,1-dimethylfuro[3,4-c]pyridin-3-one?
The canonical SMILES for 4-amino-1,1-dimethylfuro[3,4-c]pyridin-3-one is CC1(C)OC(=O)c2c1ccnc2N.
What is the InChIKey of 4-amino-1,1-dimethylfuro[3,4-c]pyridin-3-one?
The InChIKey is BOUMCQBREOWUEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c1-9(2)5-3-4-11-7(10)6(5)8(12)13-9/h3-4H,1-2H3,(H2,10,11).
What are the key properties of 4-amino-1,1-dimethylfuro[3,4-c]pyridin-3-one?
4-amino-1,1-dimethylfuro[3,4-c]pyridin-3-one has a molecular weight of 178.19 g/mol, XLogP of 1.07, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1,1-dimethylfuro[3,4-c]pyridin-3-one is sourced from PubChem (CID 55295877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).