About 8-methyl-1,6-naphthyridine-3-carbonitrile
8-methyl-1,6-naphthyridine-3-carbonitrile (PubChem CID 55295879) has the molecular formula C10H7N3
and a molecular weight of 169.19 g/mol. Its IUPAC name is 8-methyl-1,6-naphthyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 8-methyl-1,6-naphthyridine-3-carbonitrile |
| PubChem CID | 55295879 |
| Molecular Formula | C10H7N3 |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 8-methyl-1,6-naphthyridine-3-carbonitrile |
| SMILES | Cc1cncc2cc(C#N)cnc12 |
| InChI | InChI=1S/C10H7N3/c1-7-4-12-6-9-2-8(3-11)5-13-10(7)9/h2,4-6H,1H3 |
| InChIKey | OYGCTKHDQQKNOJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methyl-1,6-naphthyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-1,6-naphthyridine-3-carbonitrile?
The IUPAC name of 8-methyl-1,6-naphthyridine-3-carbonitrile (CID 55295879) is 8-methyl-1,6-naphthyridine-3-carbonitrile.
What is the SMILES notation for 8-methyl-1,6-naphthyridine-3-carbonitrile?
The canonical SMILES for 8-methyl-1,6-naphthyridine-3-carbonitrile is Cc1cncc2cc(C#N)cnc12.
What is the InChIKey of 8-methyl-1,6-naphthyridine-3-carbonitrile?
The InChIKey is OYGCTKHDQQKNOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3/c1-7-4-12-6-9-2-8(3-11)5-13-10(7)9/h2,4-6H,1H3.
What are the key properties of 8-methyl-1,6-naphthyridine-3-carbonitrile?
8-methyl-1,6-naphthyridine-3-carbonitrile has a molecular weight of 169.19 g/mol, XLogP of 1.81, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-1,6-naphthyridine-3-carbonitrile is sourced from PubChem (CID 55295879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).