About [2-methoxy-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl] acetate
[2-methoxy-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl] acetate (PubChem CID 552960) has the molecular formula C18H40O7Si3
and a molecular weight of 452.77 g/mol. Its IUPAC name is [2-methoxy-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl] acetate.
Molecular Properties
| Compound Name | [2-methoxy-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl] acetate |
| PubChem CID | 552960 |
| Molecular Formula | C18H40O7Si3 |
| Molecular Weight | 452.77 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | [2-methoxy-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl] acetate |
| SMILES | COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC(C)=O |
| InChI | InChI=1S/C18H40O7Si3/c1-13(19)22-17-16(25-28(9,10)11)15(24-27(6,7)8)14(23-18(17)20-2)12-21-26(3,4)5/h14-18H,12H2,1-11H3 |
| InChIKey | KERPCMOGRABNHZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.77 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-methoxy-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methoxy-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl] acetate?
The IUPAC name of [2-methoxy-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl] acetate (CID 552960) is [2-methoxy-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl] acetate.
What is the SMILES notation for [2-methoxy-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl] acetate?
The canonical SMILES for [2-methoxy-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl] acetate is COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC(C)=O.
What is the InChIKey of [2-methoxy-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl] acetate?
The InChIKey is KERPCMOGRABNHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H40O7Si3/c1-13(19)22-17-16(25-28(9,10)11)15(24-27(6,7)8)14(23-18(17)20-2)12-21-26(3,4)5/h14-18H,12H2,1-11H3.
What are the key properties of [2-methoxy-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl] acetate?
[2-methoxy-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl] acetate has a molecular weight of 452.77 g/mol, XLogP of 3.58, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methoxy-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl] acetate is sourced from PubChem (CID 552960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).