C18H40O7Si3 — CID 552961
[2-methoxy-3,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-4-yl] acetate (PubChem CID 552961) has the molecular formula C18H40O7Si3 and a molecular weight of 452.77 g/mol. Its IUPAC name is [2-methoxy-3,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-4-yl] acetate.
| Compound Name | [2-methoxy-3,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 552961 |
| Molecular Formula | C18H40O7Si3 |
| Molecular Weight | 452.77 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | [2-methoxy-3,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-4-yl] acetate |
| SMILES | COC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(OC(C)=O)C1O[Si](C)(C)C |
| InChI | InChI=1S/C18H40O7Si3/c1-13(19)22-16-15(24-27(6,7)8)14(12-21-26(3,4)5)23-18(20-2)17(16)25-28(9,10)11/h14-18H,12H2,1-11H3 |
| InChIKey | MGLGNBRTJHDFKE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.77 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|