About 3,6-diamino-2,3-dihydro-1-benzofuran-7-carboxylic acid
3,6-diamino-2,3-dihydro-1-benzofuran-7-carboxylic acid (PubChem CID 55296349) has the molecular formula C9H10N2O3
and a molecular weight of 194.19 g/mol. Its IUPAC name is 3,6-diamino-2,3-dihydro-1-benzofuran-7-carboxylic acid.
Molecular Properties
| Compound Name | 3,6-diamino-2,3-dihydro-1-benzofuran-7-carboxylic acid |
| PubChem CID | 55296349 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 3,6-diamino-2,3-dihydro-1-benzofuran-7-carboxylic acid |
| SMILES | Nc1ccc2c(c1C(=O)O)OCC2N |
| InChI | InChI=1S/C9H10N2O3/c10-5-2-1-4-6(11)3-14-8(4)7(5)9(12)13/h1-2,6H,3,10-11H2,(H,12,13) |
| InChIKey | BDYGNZSWXIPLNO-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,6-diamino-2,3-dihydro-1-benzofuran-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-diamino-2,3-dihydro-1-benzofuran-7-carboxylic acid?
The IUPAC name of 3,6-diamino-2,3-dihydro-1-benzofuran-7-carboxylic acid (CID 55296349) is 3,6-diamino-2,3-dihydro-1-benzofuran-7-carboxylic acid.
What is the SMILES notation for 3,6-diamino-2,3-dihydro-1-benzofuran-7-carboxylic acid?
The canonical SMILES for 3,6-diamino-2,3-dihydro-1-benzofuran-7-carboxylic acid is Nc1ccc2c(c1C(=O)O)OCC2N.
What is the InChIKey of 3,6-diamino-2,3-dihydro-1-benzofuran-7-carboxylic acid?
The InChIKey is BDYGNZSWXIPLNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O3/c10-5-2-1-4-6(11)3-14-8(4)7(5)9(12)13/h1-2,6H,3,10-11H2,(H,12,13).
What are the key properties of 3,6-diamino-2,3-dihydro-1-benzofuran-7-carboxylic acid?
3,6-diamino-2,3-dihydro-1-benzofuran-7-carboxylic acid has a molecular weight of 194.19 g/mol, XLogP of 0.36, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-diamino-2,3-dihydro-1-benzofuran-7-carboxylic acid is sourced from PubChem (CID 55296349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).