C7H8F3NS — CID 55296383
(1S)-3,3,3-trifluoro-1-thiophen-3-ylpropan-1-amine (PubChem CID 55296383) has the molecular formula C7H8F3NS and a molecular weight of 195.21 g/mol. Its IUPAC name is (1S)-3,3,3-trifluoro-1-thiophen-3-ylpropan-1-amine.
| Compound Name | (1S)-3,3,3-trifluoro-1-thiophen-3-ylpropan-1-amine |
|---|---|
| PubChem CID | 55296383 |
| Molecular Formula | C7H8F3NS |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | (1S)-3,3,3-trifluoro-1-thiophen-3-ylpropan-1-amine |
| SMILES | N[C@@H](CC(F)(F)F)c1ccsc1 |
| InChI | InChI=1S/C7H8F3NS/c8-7(9,10)3-6(11)5-1-2-12-4-5/h1-2,4,6H,3,11H2/t6-/m0/s1 |
| InChIKey | LLBIWSVARQOCCY-LURJTMIESA-N |
| XLogP | 2.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |