C8H11FO3 — CID 55296419
(3aR,4S,5S,6aS)-5-fluoro-4-(hydroxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 55296419) has the molecular formula C8H11FO3 and a molecular weight of 174.17 g/mol. Its IUPAC name is (3aR,4S,5S,6aS)-5-fluoro-4-(hydroxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4S,5S,6aS)-5-fluoro-4-(hydroxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 55296419 |
| Molecular Formula | C8H11FO3 |
| Molecular Weight | 174.17 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | (3aR,4S,5S,6aS)-5-fluoro-4-(hydroxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | O=C1C[C@@H]2[C@@H](CO)[C@@H](F)C[C@@H]2O1 |
| InChI | InChI=1S/C8H11FO3/c9-6-2-7-4(5(6)3-10)1-8(11)12-7/h4-7,10H,1-3H2/t4-,5-,6+,7+/m1/s1 |
| InChIKey | ZTQAMSZPBUVPSX-JWXFUTCRSA-N |
| XLogP | 0.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.17 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |