5,5-difluoro-1-methylpiperidine-2-carboxylic acid

C7H11F2NO2 — CID 55296735

IUPAC5,5-difluoro-1-methylpiperidine-2-carboxylic acid
SMILESCN1CC(F)(F)CCC1C(=O)O
InChIInChI=1S/C7H11F2NO2/c1-10-4-7(8,9)3-2-5(10)6(11)12/h5H,2-4H2,1H3,(H,11,12)
InChIKeyDUJSACKKZBGJDY-UHFFFAOYSA-N
MW179.17 g/mol
LogP0.80
Rot. Bonds1

About 5,5-difluoro-1-methylpiperidine-2-carboxylic acid

5,5-difluoro-1-methylpiperidine-2-carboxylic acid (PubChem CID 55296735) has the molecular formula C7H11F2NO2 and a molecular weight of 179.17 g/mol. Its IUPAC name is 5,5-difluoro-1-methylpiperidine-2-carboxylic acid.

Molecular Properties

Compound Name5,5-difluoro-1-methylpiperidine-2-carboxylic acid
PubChem CID55296735
Molecular FormulaC7H11F2NO2
Molecular Weight179.17 g/mol
Exact Mass179.08
IUPAC Name5,5-difluoro-1-methylpiperidine-2-carboxylic acid
SMILESCN1CC(F)(F)CCC1C(=O)O
InChIInChI=1S/C7H11F2NO2/c1-10-4-7(8,9)3-2-5(10)6(11)12/h5H,2-4H2,1H3,(H,11,12)
InChIKeyDUJSACKKZBGJDY-UHFFFAOYSA-N
XLogP0.80
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500179.17
LogP ≤ 50.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 5,5-difluoro-1-methylpiperidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,5-difluoro-1-methylpiperidine-2-carboxylic acid?
The IUPAC name of 5,5-difluoro-1-methylpiperidine-2-carboxylic acid (CID 55296735) is 5,5-difluoro-1-methylpiperidine-2-carboxylic acid.
What is the SMILES notation for 5,5-difluoro-1-methylpiperidine-2-carboxylic acid?
The canonical SMILES for 5,5-difluoro-1-methylpiperidine-2-carboxylic acid is CN1CC(F)(F)CCC1C(=O)O.
What is the InChIKey of 5,5-difluoro-1-methylpiperidine-2-carboxylic acid?
The InChIKey is DUJSACKKZBGJDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F2NO2/c1-10-4-7(8,9)3-2-5(10)6(11)12/h5H,2-4H2,1H3,(H,11,12).
What are the key properties of 5,5-difluoro-1-methylpiperidine-2-carboxylic acid?
5,5-difluoro-1-methylpiperidine-2-carboxylic acid has a molecular weight of 179.17 g/mol, XLogP of 0.80, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-difluoro-1-methylpiperidine-2-carboxylic acid is sourced from PubChem (CID 55296735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).