About 4-chloro-7-ethylimidazo[4,5-c]pyridazine
4-chloro-7-ethylimidazo[4,5-c]pyridazine (PubChem CID 55296765) has the molecular formula C7H7ClN4
and a molecular weight of 182.61 g/mol. Its IUPAC name is 4-chloro-7-ethylimidazo[4,5-c]pyridazine.
Molecular Properties
| Compound Name | 4-chloro-7-ethylimidazo[4,5-c]pyridazine |
| PubChem CID | 55296765 |
| Molecular Formula | C7H7ClN4 |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 4-chloro-7-ethylimidazo[4,5-c]pyridazine |
| SMILES | CCn1cnc2c(Cl)cnnc21 |
| InChI | InChI=1S/C7H7ClN4/c1-2-12-4-9-6-5(8)3-10-11-7(6)12/h3-4H,2H2,1H3 |
| InChIKey | QQIOFEOYBPQDIA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-7-ethylimidazo[4,5-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-7-ethylimidazo[4,5-c]pyridazine?
The IUPAC name of 4-chloro-7-ethylimidazo[4,5-c]pyridazine (CID 55296765) is 4-chloro-7-ethylimidazo[4,5-c]pyridazine.
What is the SMILES notation for 4-chloro-7-ethylimidazo[4,5-c]pyridazine?
The canonical SMILES for 4-chloro-7-ethylimidazo[4,5-c]pyridazine is CCn1cnc2c(Cl)cnnc21.
What is the InChIKey of 4-chloro-7-ethylimidazo[4,5-c]pyridazine?
The InChIKey is QQIOFEOYBPQDIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClN4/c1-2-12-4-9-6-5(8)3-10-11-7(6)12/h3-4H,2H2,1H3.
What are the key properties of 4-chloro-7-ethylimidazo[4,5-c]pyridazine?
4-chloro-7-ethylimidazo[4,5-c]pyridazine has a molecular weight of 182.61 g/mol, XLogP of 1.50, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-7-ethylimidazo[4,5-c]pyridazine is sourced from PubChem (CID 55296765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).