About potassium trifluoro-(3-hydroxy-3-methylcyclobutyl)boranuide
potassium trifluoro-(3-hydroxy-3-methylcyclobutyl)boranuide (PubChem CID 55297001) has the molecular formula C5H9BF3KO
and a molecular weight of 192.03 g/mol. Its IUPAC name is potassium trifluoro-(3-hydroxy-3-methylcyclobutyl)boranuide.
Molecular Properties
| Compound Name | potassium trifluoro-(3-hydroxy-3-methylcyclobutyl)boranuide |
| PubChem CID | 55297001 |
| Molecular Formula | C5H9BF3KO |
| Molecular Weight | 192.03 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | potassium trifluoro-(3-hydroxy-3-methylcyclobutyl)boranuide |
| SMILES | CC1(O)CC([B-](F)(F)F)C1.[K+] |
| InChI | InChI=1S/C5H9BF3O.K/c1-5(10)2-4(3-5)6(7,8)9;/h4,10H,2-3H2,1H3;/q-1;+1 |
| InChIKey | MBZOBFPLUBGHSO-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.03 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium trifluoro-(3-hydroxy-3-methylcyclobutyl)boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium trifluoro-(3-hydroxy-3-methylcyclobutyl)boranuide?
The IUPAC name of potassium trifluoro-(3-hydroxy-3-methylcyclobutyl)boranuide (CID 55297001) is potassium trifluoro-(3-hydroxy-3-methylcyclobutyl)boranuide.
What is the SMILES notation for potassium trifluoro-(3-hydroxy-3-methylcyclobutyl)boranuide?
The canonical SMILES for potassium trifluoro-(3-hydroxy-3-methylcyclobutyl)boranuide is CC1(O)CC([B-](F)(F)F)C1.[K+].
What is the InChIKey of potassium trifluoro-(3-hydroxy-3-methylcyclobutyl)boranuide?
The InChIKey is MBZOBFPLUBGHSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9BF3O.K/c1-5(10)2-4(3-5)6(7,8)9;/h4,10H,2-3H2,1H3;/q-1;+1.
What are the key properties of potassium trifluoro-(3-hydroxy-3-methylcyclobutyl)boranuide?
potassium trifluoro-(3-hydroxy-3-methylcyclobutyl)boranuide has a molecular weight of 192.03 g/mol, XLogP of -1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium trifluoro-(3-hydroxy-3-methylcyclobutyl)boranuide is sourced from PubChem (CID 55297001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).