C10H14N2O2 — CID 55297559
2-amino-2-(4-amino-3,5-dimethylphenyl)acetic acid (PubChem CID 55297559) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-amino-2-(4-amino-3,5-dimethylphenyl)acetic acid.
| Compound Name | 2-amino-2-(4-amino-3,5-dimethylphenyl)acetic acid |
|---|---|
| PubChem CID | 55297559 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-amino-2-(4-amino-3,5-dimethylphenyl)acetic acid |
| SMILES | Cc1cc(C(N)C(=O)O)cc(C)c1N |
| InChI | InChI=1S/C10H14N2O2/c1-5-3-7(9(12)10(13)14)4-6(2)8(5)11/h3-4,9H,11-12H2,1-2H3,(H,13,14) |
| InChIKey | MZNDVTPIHCQYNC-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|