C10H13NO3 — CID 55297577
(6S)-6-amino-5,6,7,8-tetrahydronaphthalene-1,2,3-triol (PubChem CID 55297577) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is (6S)-6-amino-5,6,7,8-tetrahydronaphthalene-1,2,3-triol.
| Compound Name | (6S)-6-amino-5,6,7,8-tetrahydronaphthalene-1,2,3-triol |
|---|---|
| PubChem CID | 55297577 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | (6S)-6-amino-5,6,7,8-tetrahydronaphthalene-1,2,3-triol |
| SMILES | N[C@H]1CCc2c(cc(O)c(O)c2O)C1 |
| InChI | InChI=1S/C10H13NO3/c11-6-1-2-7-5(3-6)4-8(12)10(14)9(7)13/h4,6,12-14H,1-3,11H2/t6-/m0/s1 |
| InChIKey | WJXSUFMNWCUPRB-LURJTMIESA-N |
| XLogP | 0.62 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|