About (Z)-N,N-dimethyl-3-(methylamino)prop-2-enamide
(Z)-N,N-dimethyl-3-(methylamino)prop-2-enamide (PubChem CID 55298123) has the molecular formula C6H12N2O
and a molecular weight of 128.17 g/mol. Its IUPAC name is (Z)-N,N-dimethyl-3-(methylamino)prop-2-enamide.
Molecular Properties
| Compound Name | (Z)-N,N-dimethyl-3-(methylamino)prop-2-enamide |
| PubChem CID | 55298123 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | (Z)-N,N-dimethyl-3-(methylamino)prop-2-enamide |
| SMILES | CN/C=C\C(=O)N(C)C |
| InChI | InChI=1S/C6H12N2O/c1-7-5-4-6(9)8(2)3/h4-5,7H,1-3H3/b5-4- |
| InChIKey | MGNMHJPOUPUGRD-PLNGDYQASA-N |
| XLogP | -0.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N,N-dimethyl-3-(methylamino)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,N-dimethyl-3-(methylamino)prop-2-enamide?
The IUPAC name of (Z)-N,N-dimethyl-3-(methylamino)prop-2-enamide (CID 55298123) is (Z)-N,N-dimethyl-3-(methylamino)prop-2-enamide.
What is the SMILES notation for (Z)-N,N-dimethyl-3-(methylamino)prop-2-enamide?
The canonical SMILES for (Z)-N,N-dimethyl-3-(methylamino)prop-2-enamide is CN/C=C\C(=O)N(C)C.
What is the InChIKey of (Z)-N,N-dimethyl-3-(methylamino)prop-2-enamide?
The InChIKey is MGNMHJPOUPUGRD-PLNGDYQASA-N. The full InChI is InChI=1S/C6H12N2O/c1-7-5-4-6(9)8(2)3/h4-5,7H,1-3H3/b5-4-.
What are the key properties of (Z)-N,N-dimethyl-3-(methylamino)prop-2-enamide?
(Z)-N,N-dimethyl-3-(methylamino)prop-2-enamide has a molecular weight of 128.17 g/mol, XLogP of -0.19, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,N-dimethyl-3-(methylamino)prop-2-enamide is sourced from PubChem (CID 55298123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).