About (Z)-1,2,4-trichlorobut-1-ene
(Z)-1,2,4-trichlorobut-1-ene (PubChem CID 55298448) has the molecular formula C4H5Cl3
and a molecular weight of 159.44 g/mol. Its IUPAC name is (Z)-1,2,4-trichlorobut-1-ene.
Molecular Properties
| Compound Name | (Z)-1,2,4-trichlorobut-1-ene |
| PubChem CID | 55298448 |
| Molecular Formula | C4H5Cl3 |
| Molecular Weight | 159.44 g/mol |
| Exact Mass | 157.95 |
| IUPAC Name | (Z)-1,2,4-trichlorobut-1-ene |
| SMILES | Cl/C=C(\Cl)CCCl |
| InChI | InChI=1S/C4H5Cl3/c5-2-1-4(7)3-6/h3H,1-2H2/b4-3- |
| InChIKey | LJYYBTFYBAHLOR-ARJAWSKDSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1,2,4-trichlorobut-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,2,4-trichlorobut-1-ene?
The IUPAC name of (Z)-1,2,4-trichlorobut-1-ene (CID 55298448) is (Z)-1,2,4-trichlorobut-1-ene.
What is the SMILES notation for (Z)-1,2,4-trichlorobut-1-ene?
The canonical SMILES for (Z)-1,2,4-trichlorobut-1-ene is Cl/C=C(\Cl)CCCl.
What is the InChIKey of (Z)-1,2,4-trichlorobut-1-ene?
The InChIKey is LJYYBTFYBAHLOR-ARJAWSKDSA-N. The full InChI is InChI=1S/C4H5Cl3/c5-2-1-4(7)3-6/h3H,1-2H2/b4-3-.
What are the key properties of (Z)-1,2,4-trichlorobut-1-ene?
(Z)-1,2,4-trichlorobut-1-ene has a molecular weight of 159.44 g/mol, XLogP of 2.93, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,2,4-trichlorobut-1-ene is sourced from PubChem (CID 55298448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).