About 4-(chloromethyl)-1,2-dimethylcyclohexa-1,4-diene
4-(chloromethyl)-1,2-dimethylcyclohexa-1,4-diene (PubChem CID 55298467) has the molecular formula C9H13Cl
and a molecular weight of 156.66 g/mol. Its IUPAC name is 4-(chloromethyl)-1,2-dimethylcyclohexa-1,4-diene.
Molecular Properties
| Compound Name | 4-(chloromethyl)-1,2-dimethylcyclohexa-1,4-diene |
| PubChem CID | 55298467 |
| Molecular Formula | C9H13Cl |
| Molecular Weight | 156.66 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 4-(chloromethyl)-1,2-dimethylcyclohexa-1,4-diene |
| SMILES | CC1=C(C)CC(CCl)=CC1 |
| InChI | InChI=1S/C9H13Cl/c1-7-3-4-9(6-10)5-8(7)2/h4H,3,5-6H2,1-2H3 |
| InChIKey | YPJSZNDWINQUFA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.66 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethyl)-1,2-dimethylcyclohexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethyl)-1,2-dimethylcyclohexa-1,4-diene?
The IUPAC name of 4-(chloromethyl)-1,2-dimethylcyclohexa-1,4-diene (CID 55298467) is 4-(chloromethyl)-1,2-dimethylcyclohexa-1,4-diene.
What is the SMILES notation for 4-(chloromethyl)-1,2-dimethylcyclohexa-1,4-diene?
The canonical SMILES for 4-(chloromethyl)-1,2-dimethylcyclohexa-1,4-diene is CC1=C(C)CC(CCl)=CC1.
What is the InChIKey of 4-(chloromethyl)-1,2-dimethylcyclohexa-1,4-diene?
The InChIKey is YPJSZNDWINQUFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13Cl/c1-7-3-4-9(6-10)5-8(7)2/h4H,3,5-6H2,1-2H3.
What are the key properties of 4-(chloromethyl)-1,2-dimethylcyclohexa-1,4-diene?
4-(chloromethyl)-1,2-dimethylcyclohexa-1,4-diene has a molecular weight of 156.66 g/mol, XLogP of 3.28, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)-1,2-dimethylcyclohexa-1,4-diene is sourced from PubChem (CID 55298467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).