About (Z)-3-(ethylamino)-N,N-dimethylprop-2-enamide
(Z)-3-(ethylamino)-N,N-dimethylprop-2-enamide (PubChem CID 55298516) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is (Z)-3-(ethylamino)-N,N-dimethylprop-2-enamide.
Molecular Properties
| Compound Name | (Z)-3-(ethylamino)-N,N-dimethylprop-2-enamide |
| PubChem CID | 55298516 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | (Z)-3-(ethylamino)-N,N-dimethylprop-2-enamide |
| SMILES | CCN/C=C\C(=O)N(C)C |
| InChI | InChI=1S/C7H14N2O/c1-4-8-6-5-7(10)9(2)3/h5-6,8H,4H2,1-3H3/b6-5- |
| InChIKey | PHHBZVHVOATDTP-WAYWQWQTSA-N |
| XLogP | 0.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-(ethylamino)-N,N-dimethylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-(ethylamino)-N,N-dimethylprop-2-enamide?
The IUPAC name of (Z)-3-(ethylamino)-N,N-dimethylprop-2-enamide (CID 55298516) is (Z)-3-(ethylamino)-N,N-dimethylprop-2-enamide.
What is the SMILES notation for (Z)-3-(ethylamino)-N,N-dimethylprop-2-enamide?
The canonical SMILES for (Z)-3-(ethylamino)-N,N-dimethylprop-2-enamide is CCN/C=C\C(=O)N(C)C.
What is the InChIKey of (Z)-3-(ethylamino)-N,N-dimethylprop-2-enamide?
The InChIKey is PHHBZVHVOATDTP-WAYWQWQTSA-N. The full InChI is InChI=1S/C7H14N2O/c1-4-8-6-5-7(10)9(2)3/h5-6,8H,4H2,1-3H3/b6-5-.
What are the key properties of (Z)-3-(ethylamino)-N,N-dimethylprop-2-enamide?
(Z)-3-(ethylamino)-N,N-dimethylprop-2-enamide has a molecular weight of 142.20 g/mol, XLogP of 0.20, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-(ethylamino)-N,N-dimethylprop-2-enamide is sourced from PubChem (CID 55298516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).