C5H7ClO4 — CID 55298555
(3S,4S,5S)-5-(chloromethyl)-3,4-dihydroxyoxolan-2-one (PubChem CID 55298555) has the molecular formula C5H7ClO4 and a molecular weight of 166.56 g/mol. Its IUPAC name is (3S,4S,5S)-5-(chloromethyl)-3,4-dihydroxyoxolan-2-one.
| Compound Name | (3S,4S,5S)-5-(chloromethyl)-3,4-dihydroxyoxolan-2-one |
|---|---|
| PubChem CID | 55298555 |
| Molecular Formula | C5H7ClO4 |
| Molecular Weight | 166.56 g/mol |
| Exact Mass | 166.00 |
| IUPAC Name | (3S,4S,5S)-5-(chloromethyl)-3,4-dihydroxyoxolan-2-one |
| SMILES | O=C1O[C@H](CCl)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C5H7ClO4/c6-1-2-3(7)4(8)5(9)10-2/h2-4,7-8H,1H2/t2-,3-,4+/m1/s1 |
| InChIKey | CBQUKTYYJALFIT-JJYYJPOSSA-N |
| XLogP | -1.13 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.56 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|